C18H9N7O2 — CID 168609279
7-[3-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[1,5-a]pyrimidine-2-carboxylic acid (PubChem CID 168609279) has the molecular formula C18H9N7O2 and a molecular weight of 355.32 g/mol. Its IUPAC name is 7-[3-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[1,5-a]pyrimidine-2-carboxylic acid.
| Compound Name | 7-[3-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 168609279 |
| Molecular Formula | C18H9N7O2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 7-[3-(1,2,2-tricyanoethenylamino)phenyl]pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc(-c2ccnc3cc(C(=O)O)nn23)c1 |
| InChI | InChI=1S/C18H9N7O2/c19-8-12(9-20)15(10-21)23-13-3-1-2-11(6-13)16-4-5-22-17-7-14(18(26)27)24-25(16)17/h1-7,23H,(H,26,27) |
| InChIKey | PCDNHFXAFIVFDQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 150.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|