C14H12N4O2S — CID 168609520
2-(3-propan-2-ylsulfonylanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168609520) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-(3-propan-2-ylsulfonylanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(3-propan-2-ylsulfonylanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609520 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-(3-propan-2-ylsulfonylanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | CC(C)S(=O)(=O)c1cccc(NC(C#N)=C(C#N)C#N)c1 |
| InChI | InChI=1S/C14H12N4O2S/c1-10(2)21(19,20)13-5-3-4-12(6-13)18-14(9-17)11(7-15)8-16/h3-6,10,18H,1-2H3 |
| InChIKey | CTXWGELQKMSXAJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|