C17H24N4S — CID 168617446
N-[[3-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168617446) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is N-[[3-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[3-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168617446 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[[3-[[butyl(methyl)amino]methyl]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCN(C)Cc1cccc(C=NNc2nc(C)cs2)c1 |
| InChI | InChI=1S/C17H24N4S/c1-4-5-9-21(3)12-16-8-6-7-15(10-16)11-18-20-17-19-14(2)13-22-17/h6-8,10-11,13H,4-5,9,12H2,1-3H3,(H,19,20) |
| InChIKey | CHWZCISWOHIIOM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|