C14H10F2N4S — CID 168618071
N-[(5,7-difluoroquinolin-6-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168618071) has the molecular formula C14H10F2N4S and a molecular weight of 304.33 g/mol. Its IUPAC name is N-[(5,7-difluoroquinolin-6-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(5,7-difluoroquinolin-6-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168618071 |
| Molecular Formula | C14H10F2N4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-[(5,7-difluoroquinolin-6-yl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2c(F)cc3ncccc3c2F)n1 |
| InChI | InChI=1S/C14H10F2N4S/c1-8-7-21-14(19-8)20-18-6-10-11(15)5-12-9(13(10)16)3-2-4-17-12/h2-7H,1H3,(H,19,20) |
| InChIKey | TXLKNLCWVBUJBP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|