C13H13BrFN3S — CID 168619430
N-[(3-bromo-4-fluoro-2,6-dimethylphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168619430) has the molecular formula C13H13BrFN3S and a molecular weight of 342.24 g/mol. Its IUPAC name is N-[(3-bromo-4-fluoro-2,6-dimethylphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(3-bromo-4-fluoro-2,6-dimethylphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619430 |
| Molecular Formula | C13H13BrFN3S |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | N-[(3-bromo-4-fluoro-2,6-dimethylphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2c(C)cc(F)c(Br)c2C)n1 |
| InChI | InChI=1S/C13H13BrFN3S/c1-7-4-11(15)12(14)9(3)10(7)5-16-18-13-17-8(2)6-19-13/h4-6H,1-3H3,(H,17,18) |
| InChIKey | VPUQNRXGXJSMER-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|