C24H24N4O4S — CID 168619088
N-[[2-[[2-(2,5-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168619088) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[[2-[[2-(2,5-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[2-[[2-(2,5-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619088 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[[2-[[2-(2,5-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy]phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc(OC)c(-c2nc(COc3ccccc3C=NNc3nc(C)cs3)c(C)o2)c1 |
| InChI | InChI=1S/C24H24N4O4S/c1-15-14-33-24(26-15)28-25-12-17-7-5-6-8-21(17)31-13-20-16(2)32-23(27-20)19-11-18(29-3)9-10-22(19)30-4/h5-12,14H,13H2,1-4H3,(H,26,28) |
| InChIKey | LLTYQIDTZMXBPO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|