C14H13N5S — CID 168619373
N-[[3-(1H-imidazol-5-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168619373) has the molecular formula C14H13N5S and a molecular weight of 283.36 g/mol. Its IUPAC name is N-[[3-(1H-imidazol-5-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[3-(1H-imidazol-5-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619373 |
| Molecular Formula | C14H13N5S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-[[3-(1H-imidazol-5-yl)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2cccc(-c3cnc[nH]3)c2)n1 |
| InChI | InChI=1S/C14H13N5S/c1-10-8-20-14(18-10)19-17-6-11-3-2-4-12(5-11)13-7-15-9-16-13/h2-9H,1H3,(H,15,16)(H,18,19) |
| InChIKey | WCAONOBBWMZHFW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|