C18H15N5O7S — CID 168621493
2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621493) has the molecular formula C18H15N5O7S and a molecular weight of 445.41 g/mol. Its IUPAC name is 2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621493 |
| Molecular Formula | C18H15N5O7S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[2-[[3-methoxy-4-[(3-nitro-2-pyridinyl)oxy]phenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc(C=NN=C2NC(=O)C(CC(=O)O)S2)ccc1Oc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N5O7S/c1-29-13-7-10(9-20-22-18-21-16(26)14(31-18)8-15(24)25)4-5-12(13)30-17-11(23(27)28)3-2-6-19-17/h2-7,9,14H,8H2,1H3,(H,24,25)(H,21,22,26) |
| InChIKey | LVYWFKJXMNMKRR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|