C13H12BrN3O5S2 — CID 168621534
2-[2-[(3-bromo-4-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621534) has the molecular formula C13H12BrN3O5S2 and a molecular weight of 434.29 g/mol. Its IUPAC name is 2-[2-[(3-bromo-4-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(3-bromo-4-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621534 |
| Molecular Formula | C13H12BrN3O5S2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 432.94 |
| IUPAC Name | 2-[2-[(3-bromo-4-methylsulfonylphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CS(=O)(=O)c1ccc(C=NN=C2NC(=O)C(CC(=O)O)S2)cc1Br |
| InChI | InChI=1S/C13H12BrN3O5S2/c1-24(21,22)10-3-2-7(4-8(10)14)6-15-17-13-16-12(20)9(23-13)5-11(18)19/h2-4,6,9H,5H2,1H3,(H,18,19)(H,16,17,20) |
| InChIKey | VILGIWGBTVASLK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 125.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|