C22H22BrN3O3S2 — CID 16862179
1-(benzenesulfonyl)-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide (PubChem CID 16862179) has the molecular formula C22H22BrN3O3S2 and a molecular weight of 520.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16862179 |
| Molecular Formula | C22H22BrN3O3S2 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(6-bromo-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-3-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CCCN(S(=O)(=O)c3ccccc3)C2)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C22H22BrN3O3S2/c1-2-12-26-19-11-10-17(23)14-20(19)30-22(26)24-21(27)16-7-6-13-25(15-16)31(28,29)18-8-4-3-5-9-18/h2-5,8-11,14,16H,1,6-7,12-13,15H2/b24-22- |
| InChIKey | ILQZMPULWPEECL-GYHWCHFESA-N |
| XLogP | 4.18 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|