C19H15ClN4O5S2 — CID 168622225
2-[2-[[2-[(4-chlorophenyl)methylsulfanyl]-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622225) has the molecular formula C19H15ClN4O5S2 and a molecular weight of 478.94 g/mol. Its IUPAC name is 2-[2-[[2-[(4-chlorophenyl)methylsulfanyl]-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[2-[(4-chlorophenyl)methylsulfanyl]-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622225 |
| Molecular Formula | C19H15ClN4O5S2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 2-[2-[[2-[(4-chlorophenyl)methylsulfanyl]-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2cc([N+](=O)[O-])ccc2SCc2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C19H15ClN4O5S2/c20-13-3-1-11(2-4-13)10-30-15-6-5-14(24(28)29)7-12(15)9-21-23-19-22-18(27)16(31-19)8-17(25)26/h1-7,9,16H,8,10H2,(H,25,26)(H,22,23,27) |
| InChIKey | AOWIXLVGRCHVHO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 134.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|