C17H20F2N4O4S2 — CID 168623808
ethyl 2-[2-[2-[[2,6-difluoro-3-(propylsulfonylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623808) has the molecular formula C17H20F2N4O4S2 and a molecular weight of 446.50 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2,6-difluoro-3-(propylsulfonylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2,6-difluoro-3-(propylsulfonylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623808 |
| Molecular Formula | C17H20F2N4O4S2 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | ethyl 2-[2-[2-[[2,6-difluoro-3-(propylsulfonylamino)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(C=NNc2nc(CC(=O)OCC)cs2)c1F |
| InChI | InChI=1S/C17H20F2N4O4S2/c1-3-7-29(25,26)23-14-6-5-13(18)12(16(14)19)9-20-22-17-21-11(10-28-17)8-15(24)27-4-2/h5-6,9-10,23H,3-4,7-8H2,1-2H3,(H,21,22) |
| InChIKey | YNAKMNDFLCGMCQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|