C14H12BrF2N3O2S — CID 168624133
ethyl 2-[2-[2-[(2-bromo-4,6-difluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624133) has the molecular formula C14H12BrF2N3O2S and a molecular weight of 404.24 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(2-bromo-4,6-difluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(2-bromo-4,6-difluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624133 |
| Molecular Formula | C14H12BrF2N3O2S |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | ethyl 2-[2-[2-[(2-bromo-4,6-difluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2c(F)cc(F)cc2Br)n1 |
| InChI | InChI=1S/C14H12BrF2N3O2S/c1-2-22-13(21)5-9-7-23-14(19-9)20-18-6-10-11(15)3-8(16)4-12(10)17/h3-4,6-7H,2,5H2,1H3,(H,19,20) |
| InChIKey | FJGWVVXSTCXCST-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|