C18H19BrFN3O5S — CID 168625041
ethyl 2-[2-[2-[[5-bromo-2-(2-ethoxy-2-oxoethoxy)-3-fluorophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625041) has the molecular formula C18H19BrFN3O5S and a molecular weight of 488.34 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[5-bromo-2-(2-ethoxy-2-oxoethoxy)-3-fluorophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[5-bromo-2-(2-ethoxy-2-oxoethoxy)-3-fluorophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625041 |
| Molecular Formula | C18H19BrFN3O5S |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | ethyl 2-[2-[2-[[5-bromo-2-(2-ethoxy-2-oxoethoxy)-3-fluorophenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)COc1c(F)cc(Br)cc1C=NNc1nc(CC(=O)OCC)cs1 |
| InChI | InChI=1S/C18H19BrFN3O5S/c1-3-26-15(24)7-13-10-29-18(22-13)23-21-8-11-5-12(19)6-14(20)17(11)28-9-16(25)27-4-2/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,22,23) |
| InChIKey | LVRDUWUYOWZXRW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|