C18H21BrFN3O2S — CID 168623790
ethyl 2-[2-[2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623790) has the molecular formula C18H21BrFN3O2S and a molecular weight of 442.35 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623790 |
| Molecular Formula | C18H21BrFN3O2S |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | ethyl 2-[2-[2-[(3-bromo-5-tert-butyl-2-fluorophenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(C(C)(C)C)cc(Br)c2F)n1 |
| InChI | InChI=1S/C18H21BrFN3O2S/c1-5-25-15(24)8-13-10-26-17(22-13)23-21-9-11-6-12(18(2,3)4)7-14(19)16(11)20/h6-7,9-10H,5,8H2,1-4H3,(H,22,23) |
| InChIKey | YKUXWXUBPYQWTN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|