C16H16BrN3O4S — CID 168625418
methyl 3-bromo-2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoate (PubChem CID 168625418) has the molecular formula C16H16BrN3O4S and a molecular weight of 426.29 g/mol. Its IUPAC name is methyl 3-bromo-2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 3-bromo-2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 168625418 |
| Molecular Formula | C16H16BrN3O4S |
| Molecular Weight | 426.29 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | methyl 3-bromo-2-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2c(Br)cccc2C(=O)OC)n1 |
| InChI | InChI=1S/C16H16BrN3O4S/c1-3-24-14(21)7-10-9-25-16(19-10)20-18-8-12-11(15(22)23-2)5-4-6-13(12)17/h4-6,8-9H,3,7H2,1-2H3,(H,19,20) |
| InChIKey | YDTHQZULRXLFJU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|