C21H21N3O5S2 — CID 168624426
ethyl 2-[2-[2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624426) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624426 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | ethyl 2-[2-[2-[[4-(4-methylphenyl)sulfonyloxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)n1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-3-28-20(25)12-17-14-30-21(23-17)24-22-13-16-6-8-18(9-7-16)29-31(26,27)19-10-4-15(2)5-11-19/h4-11,13-14H,3,12H2,1-2H3,(H,23,24) |
| InChIKey | DTAWRFTUSAUNCL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|