C27H30N4O2S — CID 168624467
ethyl 2-[2-[2-[(1-benzyl-2,2,4-trimethylquinolin-6-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624467) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(1-benzyl-2,2,4-trimethylquinolin-6-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(1-benzyl-2,2,4-trimethylquinolin-6-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624467 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | ethyl 2-[2-[2-[(1-benzyl-2,2,4-trimethylquinolin-6-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc3c(c2)C(C)=CC(C)(C)N3Cc2ccccc2)n1 |
| InChI | InChI=1S/C27H30N4O2S/c1-5-33-25(32)14-22-18-34-26(29-22)30-28-16-21-11-12-24-23(13-21)19(2)15-27(3,4)31(24)17-20-9-7-6-8-10-20/h6-13,15-16,18H,5,14,17H2,1-4H3,(H,29,30) |
| InChIKey | CMQIYLBBUBTQIC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|