C25H33N5O5S — CID 168624801
ethyl 2-[2-[2-[[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carbonyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168624801) has the molecular formula C25H33N5O5S and a molecular weight of 515.64 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carbonyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carbonyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168624801 |
| Molecular Formula | C25H33N5O5S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | ethyl 2-[2-[2-[[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carbonyl]phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(C(=O)N3CCC(NC(=O)OC(C)(C)C)CC3)cc2)n1 |
| InChI | InChI=1S/C25H33N5O5S/c1-5-34-21(31)14-20-16-36-23(27-20)29-26-15-17-6-8-18(9-7-17)22(32)30-12-10-19(11-13-30)28-24(33)35-25(2,3)4/h6-9,15-16,19H,5,10-14H2,1-4H3,(H,27,29)(H,28,33) |
| InChIKey | GQHMSDDJHCZMTH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|