C21H20BrF4N5O3S — CID 168625288
ethyl 2-[2-[2-[[3-[[4-bromo-3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625288) has the molecular formula C21H20BrF4N5O3S and a molecular weight of 578.39 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[3-[[4-bromo-3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[3-[[4-bromo-3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625288 |
| Molecular Formula | C21H20BrF4N5O3S |
| Molecular Weight | 578.39 g/mol |
| Exact Mass | 577.04 |
| IUPAC Name | ethyl 2-[2-[2-[[3-[[4-bromo-3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-methoxyphenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2ccc(OC)c(Cn3nc(C(F)F)c(Br)c3C(F)F)c2)n1 |
| InChI | InChI=1S/C21H20BrF4N5O3S/c1-3-34-15(32)7-13-10-35-21(28-13)29-27-8-11-4-5-14(33-2)12(6-11)9-31-18(20(25)26)16(22)17(30-31)19(23)24/h4-6,8,10,19-20H,3,7,9H2,1-2H3,(H,28,29) |
| InChIKey | JDPUQYHZPMKTIP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|