C16H16FN3O4S — CID 168625364
ethyl 2-[2-[2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168625364) has the molecular formula C16H16FN3O4S and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168625364 |
| Molecular Formula | C16H16FN3O4S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | ethyl 2-[2-[2-[(6-fluoro-4H-1,3-benzodioxin-8-yl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(F)cc3c2OCOC3)n1 |
| InChI | InChI=1S/C16H16FN3O4S/c1-2-23-14(21)5-13-8-25-16(19-13)20-18-6-10-3-12(17)4-11-7-22-9-24-15(10)11/h3-4,6,8H,2,5,7,9H2,1H3,(H,19,20) |
| InChIKey | OVKQEJLNIOQVSY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|