C17H14F2N4OS — CID 168626092
2-N-[[4-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626092) has the molecular formula C17H14F2N4OS and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-N-[[4-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626092 |
| Molecular Formula | C17H14F2N4OS |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-N-[[4-[(2,4-difluorophenyl)methoxy]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2ccc(OCc3ccc(F)cc3F)cc2)n1 |
| InChI | InChI=1S/C17H14F2N4OS/c18-13-4-3-12(15(19)7-13)9-24-14-5-1-11(2-6-14)8-21-23-17-22-16(20)10-25-17/h1-8,10H,9,20H2,(H,22,23) |
| InChIKey | GXUHJNWYHUOZPD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|