C12H15BN4O3S — CID 168626759
[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-ethoxyphenyl]boronic acid (PubChem CID 168626759) has the molecular formula C12H15BN4O3S and a molecular weight of 306.16 g/mol. Its IUPAC name is [3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-ethoxyphenyl]boronic acid.
| Compound Name | [3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-ethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168626759 |
| Molecular Formula | C12H15BN4O3S |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-5-ethoxyphenyl]boronic acid |
| SMILES | CCOc1cc(C=NNc2nc(N)cs2)cc(B(O)O)c1 |
| InChI | InChI=1S/C12H15BN4O3S/c1-2-20-10-4-8(3-9(5-10)13(18)19)6-15-17-12-16-11(14)7-21-12/h3-7,18-19H,2,14H2,1H3,(H,16,17) |
| InChIKey | FGCFBEBCTCGSJP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|