C16H17ClN6O — CID 168629441
1-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-4-methylimidazol-2-amine (PubChem CID 168629441) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is 1-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-4-methylimidazol-2-amine.
| Compound Name | 1-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 168629441 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]-4-methylimidazol-2-amine |
| SMILES | COc1ccc(C=Nn2cc(C)nc2N)cc1Cn1cc(Cl)cn1 |
| InChI | InChI=1S/C16H17ClN6O/c1-11-8-23(16(18)21-11)20-6-12-3-4-15(24-2)13(5-12)9-22-10-14(17)7-19-22/h3-8,10H,9H2,1-2H3,(H2,18,21) |
| InChIKey | HBSMFIOPKCNKPQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|