C17H24N6O2S — CID 168630650
4-methyl-1-[[4-(4-methylpiperazin-1-yl)-2-methylsulfonylphenyl]methylideneamino]imidazol-2-amine (PubChem CID 168630650) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is 4-methyl-1-[[4-(4-methylpiperazin-1-yl)-2-methylsulfonylphenyl]methylideneamino]imidazol-2-amine.
| Compound Name | 4-methyl-1-[[4-(4-methylpiperazin-1-yl)-2-methylsulfonylphenyl]methylideneamino]imidazol-2-amine |
|---|---|
| PubChem CID | 168630650 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 4-methyl-1-[[4-(4-methylpiperazin-1-yl)-2-methylsulfonylphenyl]methylideneamino]imidazol-2-amine |
| SMILES | Cc1cn(N=Cc2ccc(N3CCN(C)CC3)cc2S(C)(=O)=O)c(N)n1 |
| InChI | InChI=1S/C17H24N6O2S/c1-13-12-23(17(18)20-13)19-11-14-4-5-15(10-16(14)26(3,24)25)22-8-6-21(2)7-9-22/h4-5,10-12H,6-9H2,1-3H3,(H2,18,20) |
| InChIKey | OTTJFXNZXORFFT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|