C14H16BNO7 — CID 168631517
[3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]boronic acid (PubChem CID 168631517) has the molecular formula C14H16BNO7 and a molecular weight of 321.09 g/mol. Its IUPAC name is [3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]boronic acid.
| Compound Name | [3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 168631517 |
| Molecular Formula | C14H16BNO7 |
| Molecular Weight | 321.09 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]boronic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(B(O)O)c2)COC1 |
| InChI | InChI=1S/C14H16BNO7/c1-21-13(17)11-7-23-8-16(12(11)14(18)22-2)10-5-3-4-9(6-10)15(19)20/h3-6,19-20H,7-8H2,1-2H3 |
| InChIKey | CMWWNOVSYXFHJV-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.09 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|