C17H17NO7 — CID 168633227
3-[3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]prop-2-enoic acid (PubChem CID 168633227) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is 3-[3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 168633227 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[3-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]phenyl]prop-2-enoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(C=CC(=O)O)c2)COC1 |
| InChI | InChI=1S/C17H17NO7/c1-23-16(21)13-9-25-10-18(15(13)17(22)24-2)12-5-3-4-11(8-12)6-7-14(19)20/h3-8H,9-10H2,1-2H3,(H,19,20) |
| InChIKey | VLJVEEPLVCPRFX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|