C17H16BrNO7 — CID 168632161
3-[2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-bromophenyl]prop-2-enoic acid (PubChem CID 168632161) has the molecular formula C17H16BrNO7 and a molecular weight of 426.22 g/mol. Its IUPAC name is 3-[2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-bromophenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-bromophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 168632161 |
| Molecular Formula | C17H16BrNO7 |
| Molecular Weight | 426.22 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | 3-[2-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-4-bromophenyl]prop-2-enoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Br)ccc2C=CC(=O)O)COC1 |
| InChI | InChI=1S/C17H16BrNO7/c1-24-16(22)12-8-26-9-19(15(12)17(23)25-2)13-7-11(18)5-3-10(13)4-6-14(20)21/h3-7H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | NTFSQGVLSDAFMA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|