C17H17BrClNO6 — CID 168635675
dimethyl 3-[5-bromo-2-(3-chloropropanoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635675) has the molecular formula C17H17BrClNO6 and a molecular weight of 446.68 g/mol. Its IUPAC name is dimethyl 3-[5-bromo-2-(3-chloropropanoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[5-bromo-2-(3-chloropropanoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635675 |
| Molecular Formula | C17H17BrClNO6 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | dimethyl 3-[5-bromo-2-(3-chloropropanoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(Br)ccc2C(=O)CCCl)COC1 |
| InChI | InChI=1S/C17H17BrClNO6/c1-24-16(22)12-8-26-9-20(15(12)17(23)25-2)13-7-10(18)3-4-11(13)14(21)5-6-19/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | PNNQREHJTFHEMQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|