C22H29N3O7 — CID 168632827
dimethyl 3-[2-(3-morpholin-4-ylpropylcarbamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168632827) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is dimethyl 3-[2-(3-morpholin-4-ylpropylcarbamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-(3-morpholin-4-ylpropylcarbamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168632827 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | dimethyl 3-[2-(3-morpholin-4-ylpropylcarbamoyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccccc2C(=O)NCCCN2CCOCC2)COC1 |
| InChI | InChI=1S/C22H29N3O7/c1-29-21(27)17-14-32-15-25(19(17)22(28)30-2)18-7-4-3-6-16(18)20(26)23-8-5-9-24-10-12-31-13-11-24/h3-4,6-7H,5,8-15H2,1-2H3,(H,23,26) |
| InChIKey | MPHXZFSRDOHZDY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|