C25H29NO6 — CID 168633385
dimethyl 3-(2-pentoxy-5-phenylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168633385) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is dimethyl 3-(2-pentoxy-5-phenylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(2-pentoxy-5-phenylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168633385 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | dimethyl 3-(2-pentoxy-5-phenylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | CCCCCOc1ccc(-c2ccccc2)cc1N1COCC(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C25H29NO6/c1-4-5-9-14-32-22-13-12-19(18-10-7-6-8-11-18)15-21(22)26-17-31-16-20(24(27)29-2)23(26)25(28)30-3/h6-8,10-13,15H,4-5,9,14,16-17H2,1-3H3 |
| InChIKey | MZZBFTPSJGJJQJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|