C21H22N2O8 — CID 168633804
dimethyl 3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168633804) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is dimethyl 3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168633804 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | dimethyl 3-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)COC1 |
| InChI | InChI=1S/C21H22N2O8/c1-28-20(26)16-10-30-11-23(17(16)21(27)29-2)12-5-6-14-15(8-12)19(25)22(18(14)24)9-13-4-3-7-31-13/h5-6,8,13H,3-4,7,9-11H2,1-2H3 |
| InChIKey | PZFUWFLJIFDQLY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|