C21H19N3O9 — CID 168632577
dimethyl 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168632577) has the molecular formula C21H19N3O9 and a molecular weight of 457.40 g/mol. Its IUPAC name is dimethyl 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168632577 |
| Molecular Formula | C21H19N3O9 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | dimethyl 3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)COC1 |
| InChI | InChI=1S/C21H19N3O9/c1-31-20(29)13-8-33-9-23(16(13)21(30)32-2)10-3-4-11-12(7-10)19(28)24(18(11)27)14-5-6-15(25)22-17(14)26/h3-4,7,14H,5-6,8-9H2,1-2H3,(H,22,25,26) |
| InChIKey | QCJSRQYJESOVBN-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|