C22H20ClNO11S2 — CID 168634775
5-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 168634775) has the molecular formula C22H20ClNO11S2 and a molecular weight of 573.99 g/mol. Its IUPAC name is 5-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 168634775 |
| Molecular Formula | C22H20ClNO11S2 |
| Molecular Weight | 573.99 g/mol |
| Exact Mass | 573.02 |
| IUPAC Name | 5-[4,5-bis(methoxycarbonyl)-2,6-dihydro-1,3-oxazin-3-yl]-2-[2-(4-chloro-2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C=Cc3ccc(Cl)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)COC1 |
| InChI | InChI=1S/C22H20ClNO11S2/c1-33-21(25)17-11-35-12-24(20(17)22(26)34-2)16-8-6-14(19(10-16)37(30,31)32)4-3-13-5-7-15(23)9-18(13)36(27,28)29/h3-10H,11-12H2,1-2H3,(H,27,28,29)(H,30,31,32) |
| InChIKey | FJGSKJPRSXGASD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 173.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.99 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|