C24H32N2O6 — CID 168635193
dimethyl 3-[4-(2,2,6,6-tetramethylpiperidine-1-carbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635193) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is dimethyl 3-[4-(2,2,6,6-tetramethylpiperidine-1-carbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-[4-(2,2,6,6-tetramethylpiperidine-1-carbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635193 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | dimethyl 3-[4-(2,2,6,6-tetramethylpiperidine-1-carbonyl)phenyl]-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2ccc(C(=O)N3C(C)(C)CCCC3(C)C)cc2)COC1 |
| InChI | InChI=1S/C24H32N2O6/c1-23(2)12-7-13-24(3,4)26(23)20(27)16-8-10-17(11-9-16)25-15-32-14-18(21(28)30-5)19(25)22(29)31-6/h8-11H,7,12-15H2,1-6H3 |
| InChIKey | VZLKIEHTVMCWGO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |