C22H27N3O5 — CID 168635389
dimethyl 3-(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635389) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is dimethyl 3-(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635389 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | dimethyl 3-(5,5,7,7-tetramethyl-1,6-dihydrocyclopenta[f]indazol-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c3c(cc4[nH]ncc24)C(C)(C)CC3(C)C)COC1 |
| InChI | InChI=1S/C22H27N3O5/c1-21(2)10-22(3,4)16-14(21)7-15-12(8-23-24-15)17(16)25-11-30-9-13(19(26)28-5)18(25)20(27)29-6/h7-8H,9-11H2,1-6H3,(H,23,24) |
| InChIKey | HBTOJKYMFWXBFO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |