C17H18FNO8 — CID 168635377
dimethyl 3-(4-fluoro-2-methoxy-6-methoxycarbonylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168635377) has the molecular formula C17H18FNO8 and a molecular weight of 383.33 g/mol. Its IUPAC name is dimethyl 3-(4-fluoro-2-methoxy-6-methoxycarbonylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(4-fluoro-2-methoxy-6-methoxycarbonylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168635377 |
| Molecular Formula | C17H18FNO8 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | dimethyl 3-(4-fluoro-2-methoxy-6-methoxycarbonylphenyl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(OC)cc(F)cc2C(=O)OC)COC1 |
| InChI | InChI=1S/C17H18FNO8/c1-23-12-6-9(18)5-10(15(20)24-2)13(12)19-8-27-7-11(16(21)25-3)14(19)17(22)26-4/h5-6H,7-8H2,1-4H3 |
| InChIKey | LFTRFEOTRTXCPS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|