C18H19NO9 — CID 168634267
dimethyl 3-(5,6-dimethoxy-3-oxo-1H-2-benzofuran-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate (PubChem CID 168634267) has the molecular formula C18H19NO9 and a molecular weight of 393.35 g/mol. Its IUPAC name is dimethyl 3-(5,6-dimethoxy-3-oxo-1H-2-benzofuran-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate.
| Compound Name | dimethyl 3-(5,6-dimethoxy-3-oxo-1H-2-benzofuran-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 168634267 |
| Molecular Formula | C18H19NO9 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | dimethyl 3-(5,6-dimethoxy-3-oxo-1H-2-benzofuran-4-yl)-2,6-dihydro-1,3-oxazine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(OC)c(OC)cc3c2C(=O)OC3)COC1 |
| InChI | InChI=1S/C18H19NO9/c1-23-11-5-9-6-28-17(21)12(9)14(15(11)24-2)19-8-27-7-10(16(20)25-3)13(19)18(22)26-4/h5H,6-8H2,1-4H3 |
| InChIKey | WUWIYTNZDROQHK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|