C19H27N3O4S — CID 16863808
3,3-dimethyl-4-[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]piperazin-2-one (PubChem CID 16863808) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 3,3-dimethyl-4-[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]piperazin-2-one.
| Compound Name | 3,3-dimethyl-4-[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]piperazin-2-one |
|---|---|
| PubChem CID | 16863808 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3,3-dimethyl-4-[4-(4-methylpiperidin-1-yl)sulfonylbenzoyl]piperazin-2-one |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(C(=O)N3CCNC(=O)C3(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O4S/c1-14-8-11-21(12-9-14)27(25,26)16-6-4-15(5-7-16)17(23)22-13-10-20-18(24)19(22,2)3/h4-7,14H,8-13H2,1-3H3,(H,20,24) |
| InChIKey | QHWYYEMIPUKXSL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |