C13H13ClFN3O3 — CID 168639938
1-[4-[(3-chloro-2-hydroxypropyl)amino]-2-fluorophenyl]pyrazole-3-carboxylic acid (PubChem CID 168639938) has the molecular formula C13H13ClFN3O3 and a molecular weight of 313.72 g/mol. Its IUPAC name is 1-[4-[(3-chloro-2-hydroxypropyl)amino]-2-fluorophenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[4-[(3-chloro-2-hydroxypropyl)amino]-2-fluorophenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 168639938 |
| Molecular Formula | C13H13ClFN3O3 |
| Molecular Weight | 313.72 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-[4-[(3-chloro-2-hydroxypropyl)amino]-2-fluorophenyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(-c2ccc(NCC(O)CCl)cc2F)n1 |
| InChI | InChI=1S/C13H13ClFN3O3/c14-6-9(19)7-16-8-1-2-12(10(15)5-8)18-4-3-11(17-18)13(20)21/h1-5,9,16,19H,6-7H2,(H,20,21) |
| InChIKey | WCIPIPBJPGBFAF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.72 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|