C25H16Cl2F7N3O4 — CID 168641444
dimethyl 6-amino-5-cyano-1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168641444) has the molecular formula C25H16Cl2F7N3O4 and a molecular weight of 626.31 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168641444 |
| Molecular Formula | C25H16Cl2F7N3O4 |
| Molecular Weight | 626.31 g/mol |
| Exact Mass | 625.04 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2Cl)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C25H16Cl2F7N3O4/c1-40-21(38)17-16(11-6-4-3-5-7-11)13(10-35)20(36)37(19(17)22(39)41-2)18-14(26)8-12(9-15(18)27)23(28,24(29,30)31)25(32,33)34/h3-9,16H,36H2,1-2H3 |
| InChIKey | PXWRYKZRVQOJAA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.31 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |