C30H24N4O8 — CID 168644495
5-[[3-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]benzoyl]amino]-2-hydroxybenzoic acid (PubChem CID 168644495) has the molecular formula C30H24N4O8 and a molecular weight of 568.54 g/mol. Its IUPAC name is 5-[[3-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]benzoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[3-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]benzoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 168644495 |
| Molecular Formula | C30H24N4O8 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 5-[[3-[2-amino-3-cyano-5,6-bis(methoxycarbonyl)-4-phenyl-4H-pyridin-1-yl]benzoyl]amino]-2-hydroxybenzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(C(=O)Nc3ccc(O)c(C(=O)O)c3)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C30H24N4O8/c1-41-29(39)24-23(16-7-4-3-5-8-16)21(15-31)26(32)34(25(24)30(40)42-2)19-10-6-9-17(13-19)27(36)33-18-11-12-22(35)20(14-18)28(37)38/h3-14,23,35H,32H2,1-2H3,(H,33,36)(H,37,38) |
| InChIKey | HOIUGLHCXAOHGZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 192.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|