C28H23N3O7 — CID 168645659
dimethyl 6-amino-5-cyano-1-[3-(5-methoxycarbonylfuran-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate (PubChem CID 168645659) has the molecular formula C28H23N3O7 and a molecular weight of 513.51 g/mol. Its IUPAC name is dimethyl 6-amino-5-cyano-1-[3-(5-methoxycarbonylfuran-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 6-amino-5-cyano-1-[3-(5-methoxycarbonylfuran-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168645659 |
| Molecular Formula | C28H23N3O7 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | dimethyl 6-amino-5-cyano-1-[3-(5-methoxycarbonylfuran-2-yl)phenyl]-4-phenyl-4H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(-c3ccc(C(=O)OC)o3)c2)C(N)=C(C#N)C1c1ccccc1 |
| InChI | InChI=1S/C28H23N3O7/c1-35-26(32)21-13-12-20(38-21)17-10-7-11-18(14-17)31-24(28(34)37-3)23(27(33)36-2)22(19(15-29)25(31)30)16-8-5-4-6-9-16/h4-14,22H,30H2,1-3H3 |
| InChIKey | YTVVFNIIXBYJPF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|