C26H33N3O6 — CID 168647017
dimethyl 1-[3-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]azepine-2,3-dicarboxylate (PubChem CID 168647017) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is dimethyl 1-[3-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[3-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168647017 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | dimethyl 1-[3-[[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]methyl]phenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cccc(CN3CCN(C(=O)OC(C)(C)C)CC3)c2)C=CC=C1 |
| InChI | InChI=1S/C26H33N3O6/c1-26(2,3)35-25(32)28-15-13-27(14-16-28)18-19-9-8-10-20(17-19)29-12-7-6-11-21(23(30)33-4)22(29)24(31)34-5/h6-12,17H,13-16,18H2,1-5H3 |
| InChIKey | OZMKAAAXRXCNSZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|