C11H14N2O3S — CID 168653982
N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)formamide (PubChem CID 168653982) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)formamide.
| Compound Name | N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)formamide |
|---|---|
| PubChem CID | 168653982 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-7-yl)formamide |
| SMILES | CS(=O)(=O)N1CCCc2ccc(NC=O)cc21 |
| InChI | InChI=1S/C11H14N2O3S/c1-17(15,16)13-6-2-3-9-4-5-10(12-8-14)7-11(9)13/h4-5,7-8H,2-3,6H2,1H3,(H,12,14) |
| InChIKey | PGILMHOWGMOYHJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|