C21H16F4N4O2 — CID 168655185
6-fluoro-4-[2-[1-(4-methoxyphenyl)triazol-4-yl]ethoxy]-2-(trifluoromethyl)quinoline (PubChem CID 168655185) has the molecular formula C21H16F4N4O2 and a molecular weight of 432.38 g/mol. Its IUPAC name is 6-fluoro-4-[2-[1-(4-methoxyphenyl)triazol-4-yl]ethoxy]-2-(trifluoromethyl)quinoline.
| Compound Name | 6-fluoro-4-[2-[1-(4-methoxyphenyl)triazol-4-yl]ethoxy]-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 168655185 |
| Molecular Formula | C21H16F4N4O2 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 6-fluoro-4-[2-[1-(4-methoxyphenyl)triazol-4-yl]ethoxy]-2-(trifluoromethyl)quinoline |
| SMILES | COc1ccc(-n2cc(CCOc3cc(C(F)(F)F)nc4ccc(F)cc34)nn2)cc1 |
| InChI | InChI=1S/C21H16F4N4O2/c1-30-16-5-3-15(4-6-16)29-12-14(27-28-29)8-9-31-19-11-20(21(23,24)25)26-18-7-2-13(22)10-17(18)19/h2-7,10-12H,8-9H2,1H3 |
| InChIKey | LMIISVCEYGBGDA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |