C8H11N5O3 — CID 168655692
4-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one (PubChem CID 168655692) has the molecular formula C8H11N5O3 and a molecular weight of 225.21 g/mol. Its IUPAC name is 4-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one.
| Compound Name | 4-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one |
|---|---|
| PubChem CID | 168655692 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(C2CONC2=O)C1 |
| InChI | InChI=1S/C8H11N5O3/c9-12-10-2-5-1-7(14)13(3-5)6-4-16-11-8(6)15/h5-6H,1-4H2,(H,11,15) |
| InChIKey | GGTXGJTUDXWGHF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|