About 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one
4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one (PubChem CID 168658949) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one |
| PubChem CID | 168658949 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one |
| SMILES | NCC1CC(=O)N(C2CONC2=O)C1 |
| InChI | InChI=1S/C8H13N3O3/c9-2-5-1-7(12)11(3-5)6-4-14-10-8(6)13/h5-6H,1-4,9H2,(H,10,13) |
| InChIKey | QKBVXVAEMKSESE-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one?
The IUPAC name of 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one (CID 168658949) is 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one.
What is the SMILES notation for 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one?
The canonical SMILES for 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one is NCC1CC(=O)N(C2CONC2=O)C1.
What is the InChIKey of 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one?
The InChIKey is QKBVXVAEMKSESE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c9-2-5-1-7(12)11(3-5)6-4-14-10-8(6)13/h5-6H,1-4,9H2,(H,10,13).
What are the key properties of 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one?
4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one has a molecular weight of 199.21 g/mol, XLogP of -1.78, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)-2-oxopyrrolidin-1-yl]-1,2-oxazolidin-3-one is sourced from PubChem (CID 168658949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).