C10H12ClN7O — CID 168656260
4-(azidomethyl)-1-[4-chloro-6-(methylamino)pyrimidin-5-yl]pyrrolidin-2-one (PubChem CID 168656260) has the molecular formula C10H12ClN7O and a molecular weight of 281.71 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[4-chloro-6-(methylamino)pyrimidin-5-yl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[4-chloro-6-(methylamino)pyrimidin-5-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168656260 |
| Molecular Formula | C10H12ClN7O |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-(azidomethyl)-1-[4-chloro-6-(methylamino)pyrimidin-5-yl]pyrrolidin-2-one |
| SMILES | CNc1ncnc(Cl)c1N1CC(CN=[N+]=[N-])CC1=O |
| InChI | InChI=1S/C10H12ClN7O/c1-13-10-8(9(11)14-5-15-10)18-4-6(2-7(18)19)3-16-17-12/h5-6H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | UQJUGUFPWBBZCC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|