C12H12F3N5O — CID 168657419
4-(azidomethyl)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-2-one (PubChem CID 168657419) has the molecular formula C12H12F3N5O and a molecular weight of 299.26 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168657419 |
| Molecular Formula | C12H12F3N5O |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-(azidomethyl)-1-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(Cc2ccc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C12H12F3N5O/c13-12(14,15)10-2-1-8(4-17-10)6-20-7-9(3-11(20)21)5-18-19-16/h1-2,4,9H,3,5-7H2 |
| InChIKey | NXGXCMPOIVMKDQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|